C31H47ClN4O6Si2 — CID 90425747
CID 90425747 (PubChem CID 90425747) has the molecular formula C31H47ClN4O6Si2 and a molecular weight of 663.36 g/mol.
| Compound Name | CID 90425747 |
|---|---|
| PubChem CID | 90425747 |
| Molecular Formula | C31H47ClN4O6Si2 |
| Molecular Weight | 663.36 g/mol |
| Exact Mass | 662.27 |
| IUPAC Name | — |
| SMILES | C[Si]OC(O[Si]C)C(C)(C)C(COc1cccc(-c2nc(Cl)c(C)c(NC3CCOCC3)n2)c1)CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H47ClN4O6Si2/c1-20-25(32)34-27(35-26(20)33-23-13-15-38-16-14-23)21-11-10-12-24(17-21)39-19-22(18-36(7)29(37)40-30(2,3)4)31(5,6)28(41-43-8)42-44-9/h10-12,17,22-23,28H,13-16,18-19H2,1-9H3,(H,33,34,35) |
| InChIKey | YJIGFHCKEXRTRG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.36 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|