C23H37NO6 — CID 90426308
[(5R)-2-oxo-5-[(E,4R)-10,10,10-trihydroxy-4-methyldec-1-en-6-ynyl]pyrrolidin-1-yl] 2-methylheptanoate (PubChem CID 90426308) has the molecular formula C23H37NO6 and a molecular weight of 423.55 g/mol. Its IUPAC name is [(5R)-2-oxo-5-[(E,4R)-10,10,10-trihydroxy-4-methyldec-1-en-6-ynyl]pyrrolidin-1-yl] 2-methylheptanoate.
| Compound Name | [(5R)-2-oxo-5-[(E,4R)-10,10,10-trihydroxy-4-methyldec-1-en-6-ynyl]pyrrolidin-1-yl] 2-methylheptanoate |
|---|---|
| PubChem CID | 90426308 |
| Molecular Formula | C23H37NO6 |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | [(5R)-2-oxo-5-[(E,4R)-10,10,10-trihydroxy-4-methyldec-1-en-6-ynyl]pyrrolidin-1-yl] 2-methylheptanoate |
| SMILES | CCCCCC(C)C(=O)ON1C(=O)CC[C@@H]1/C=C/C[C@@H](C)CC#CCCC(O)(O)O |
| InChI | InChI=1S/C23H37NO6/c1-4-5-7-13-19(3)22(26)30-24-20(15-16-21(24)25)14-10-12-18(2)11-8-6-9-17-23(27,28)29/h10,14,18-20,27-29H,4-5,7,9,11-13,15-17H2,1-3H3/b14-10+/t18-,19?,20-/m0/s1 |
| InChIKey | LTEFLFRLFKHXBH-AYPXYDEMSA-N |
| XLogP | 3.04 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|