C21H25NOS — CID 9042642
(2S)-2-(4-tert-butylphenyl)sulfanyl-N-cyclopropyl-2-phenylacetamide (PubChem CID 9042642) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylphenyl)sulfanyl-N-cyclopropyl-2-phenylacetamide.
| Compound Name | (2S)-2-(4-tert-butylphenyl)sulfanyl-N-cyclopropyl-2-phenylacetamide |
|---|---|
| PubChem CID | 9042642 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (2S)-2-(4-tert-butylphenyl)sulfanyl-N-cyclopropyl-2-phenylacetamide |
| SMILES | CC(C)(C)c1ccc(S[C@H](C(=O)NC2CC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25NOS/c1-21(2,3)16-9-13-18(14-10-16)24-19(15-7-5-4-6-8-15)20(23)22-17-11-12-17/h4-10,13-14,17,19H,11-12H2,1-3H3,(H,22,23)/t19-/m0/s1 |
| InChIKey | IJABAVFWRBATRO-IBGZPJMESA-N |
| XLogP | 5.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |