C25H30BF5N4O2 — CID 90426500
1-[(4,4-difluorocyclohexyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine (PubChem CID 90426500) has the molecular formula C25H30BF5N4O2 and a molecular weight of 524.34 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine.
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 90426500 |
| Molecular Formula | C25H30BF5N4O2 |
| Molecular Weight | 524.34 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine |
| SMILES | CC1(C)OB(c2cnc3c(-c4cnn(CC(F)(F)F)c4)cn(CC4CCC(F)(F)CC4)c3c2)OC1(C)C |
| InChI | InChI=1S/C25H30BF5N4O2/c1-22(2)23(3,4)37-26(36-22)18-9-20-21(32-11-18)19(17-10-33-35(13-17)15-25(29,30)31)14-34(20)12-16-5-7-24(27,28)8-6-16/h9-11,13-14,16H,5-8,12,15H2,1-4H3 |
| InChIKey | ZYYSWZWJVSUIBS-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.34 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|