C19H22BF2N3O3 — CID 90426509
[1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]boronic acid (PubChem CID 90426509) has the molecular formula C19H22BF2N3O3 and a molecular weight of 389.21 g/mol. Its IUPAC name is [1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]boronic acid.
| Compound Name | [1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]boronic acid |
|---|---|
| PubChem CID | 90426509 |
| Molecular Formula | C19H22BF2N3O3 |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [1-[(4,4-difluorocyclohexyl)methyl]-6-(3,5-dimethyl-1,2-oxazol-4-yl)pyrrolo[3,2-b]pyridin-3-yl]boronic acid |
| SMILES | Cc1noc(C)c1-c1cnc2c(B(O)O)cn(CC3CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C19H22BF2N3O3/c1-11-17(12(2)28-24-11)14-7-16-18(23-8-14)15(20(26)27)10-25(16)9-13-3-5-19(21,22)6-4-13/h7-8,10,13,26-27H,3-6,9H2,1-2H3 |
| InChIKey | VKKFCFGCWXGJFP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|