C25H24F3N5O2 — CID 90426644
4-[6-(3,5-dimethyltriazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoic acid (PubChem CID 90426644) has the molecular formula C25H24F3N5O2 and a molecular weight of 483.49 g/mol. Its IUPAC name is 4-[6-(3,5-dimethyltriazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoic acid.
| Compound Name | 4-[6-(3,5-dimethyltriazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoic acid |
|---|---|
| PubChem CID | 90426644 |
| Molecular Formula | C25H24F3N5O2 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 4-[6-(3,5-dimethyltriazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]pyrrolo[3,2-b]pyridin-3-yl]benzoic acid |
| SMILES | Cc1nnn(C)c1-c1cnc2c(-c3ccc(C(=O)O)cc3)cn(CC3(F)CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C25H24F3N5O2/c1-15-22(32(2)31-30-15)18-11-20-21(29-12-18)19(16-3-5-17(6-4-16)23(34)35)13-33(20)14-24(26)7-9-25(27,28)10-8-24/h3-6,11-13H,7-10,14H2,1-2H3,(H,34,35) |
| InChIKey | QZFIHWDHJHAQKL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|