C25H22N3O4PS — CID 90426750
4-[4-(benzenesulfonyl)-3-[methyl(phenyl)phosphoryl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 90426750) has the molecular formula C25H22N3O4PS and a molecular weight of 491.51 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)-3-[methyl(phenyl)phosphoryl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[4-(benzenesulfonyl)-3-[methyl(phenyl)phosphoryl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 90426750 |
| Molecular Formula | C25H22N3O4PS |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 4-[4-(benzenesulfonyl)-3-[methyl(phenyl)phosphoryl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cnc2[nH]cc(P(C)(=O)c3ccccc3)c2c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C25H22N3O4PS/c1-16-22(17(2)32-28-16)20-14-26-25-23(24(20)34(30,31)19-12-8-5-9-13-19)21(15-27-25)33(3,29)18-10-6-4-7-11-18/h4-15H,1-3H3,(H,26,27) |
| InChIKey | YFZJNXZXZKJKGZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|