C23H23F6N7 — CID 90426828
6-(3,5-dimethyltriazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine (PubChem CID 90426828) has the molecular formula C23H23F6N7 and a molecular weight of 511.47 g/mol. Its IUPAC name is 6-(3,5-dimethyltriazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine.
| Compound Name | 6-(3,5-dimethyltriazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 90426828 |
| Molecular Formula | C23H23F6N7 |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 6-(3,5-dimethyltriazol-4-yl)-1-[(1,4,4-trifluorocyclohexyl)methyl]-3-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]pyrrolo[3,2-b]pyridine |
| SMILES | Cc1nnn(C)c1-c1cnc2c(-c3cnn(CC(F)(F)F)c3)cn(CC3(F)CCC(F)(F)CC3)c2c1 |
| InChI | InChI=1S/C23H23F6N7/c1-14-20(34(2)33-32-14)15-7-18-19(30-8-15)17(16-9-31-36(10-16)13-23(27,28)29)11-35(18)12-21(24)3-5-22(25,26)6-4-21/h7-11H,3-6,12-13H2,1-2H3 |
| InChIKey | LDHKGYOKLXQEBZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|