C17H24O8 — CID 90427890
2-hydroxybutane-1,2,3-tricarboxylic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 90427890) has the molecular formula C17H24O8 and a molecular weight of 356.37 g/mol. Its IUPAC name is 2-hydroxybutane-1,2,3-tricarboxylic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | 2-hydroxybutane-1,2,3-tricarboxylic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 90427890 |
| Molecular Formula | C17H24O8 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-hydroxybutane-1,2,3-tricarboxylic acid;2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)C1CC=C(C)C(=O)C1.CC(C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H14O.C7H10O7/c1-7(2)9-5-4-8(3)10(11)6-9;1-3(5(10)11)7(14,6(12)13)2-4(8)9/h4,9H,1,5-6H2,2-3H3;3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | OSWNOAQPFFPQHL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|