C18H14IN3O3S — CID 90427953
4-[4-(benzenesulfonyl)-3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 90427953) has the molecular formula C18H14IN3O3S and a molecular weight of 479.30 g/mol. Its IUPAC name is 4-[4-(benzenesulfonyl)-3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[4-(benzenesulfonyl)-3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 90427953 |
| Molecular Formula | C18H14IN3O3S |
| Molecular Weight | 479.30 g/mol |
| Exact Mass | 478.98 |
| IUPAC Name | 4-[4-(benzenesulfonyl)-3-iodo-1H-pyrrolo[2,3-b]pyridin-5-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1-c1cnc2[nH]cc(I)c2c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14IN3O3S/c1-10-15(11(2)25-22-10)13-8-20-18-16(14(19)9-21-18)17(13)26(23,24)12-6-4-3-5-7-12/h3-9H,1-2H3,(H,20,21) |
| InChIKey | DQAMZNBTSFNWBM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.30 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|