C9H3Cl4NS — CID 90428612
7,7,8,8-tetrachloro-2-isothiocyanatobicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 90428612) has the molecular formula C9H3Cl4NS and a molecular weight of 299.01 g/mol. Its IUPAC name is 7,7,8,8-tetrachloro-2-isothiocyanatobicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | 7,7,8,8-tetrachloro-2-isothiocyanatobicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 90428612 |
| Molecular Formula | C9H3Cl4NS |
| Molecular Weight | 299.01 g/mol |
| Exact Mass | 296.87 |
| IUPAC Name | 7,7,8,8-tetrachloro-2-isothiocyanatobicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | S=C=Nc1cccc2c1C(Cl)(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C9H3Cl4NS/c10-8(11)5-2-1-3-6(14-4-15)7(5)9(8,12)13/h1-3H |
| InChIKey | DFZYBDVLVNHGTI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.01 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|