C27H41NO7 — CID 90429019
4-[(5S)-5-[(3Z,5R,6S,7S,8E)-6-hydroxy-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8-dien-2-yl]-4-oxohexyl]piperidine-2,6-dione (PubChem CID 90429019) has the molecular formula C27H41NO7 and a molecular weight of 491.63 g/mol. Its IUPAC name is 4-[(5S)-5-[(3Z,5R,6S,7S,8E)-6-hydroxy-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8-dien-2-yl]-4-oxohexyl]piperidine-2,6-dione.
| Compound Name | 4-[(5S)-5-[(3Z,5R,6S,7S,8E)-6-hydroxy-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8-dien-2-yl]-4-oxohexyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 90429019 |
| Molecular Formula | C27H41NO7 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | 4-[(5S)-5-[(3Z,5R,6S,7S,8E)-6-hydroxy-7-methoxy-3,5-dimethyl-14-oxo-1-oxacyclotetradeca-3,8-dien-2-yl]-4-oxohexyl]piperidine-2,6-dione |
| SMILES | CO[C@H]1/C=C/CCCCC(=O)OC([C@H](C)C(=O)CCCC2CC(=O)NC(=O)C2)/C(C)=C\[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C27H41NO7/c1-17-14-18(2)27(35-25(32)13-8-6-5-7-12-22(34-4)26(17)33)19(3)21(29)11-9-10-20-15-23(30)28-24(31)16-20/h7,12,14,17,19-20,22,26-27,33H,5-6,8-11,13,15-16H2,1-4H3,(H,28,30,31)/b12-7+,18-14-/t17-,19-,22+,26+,27?/m1/s1 |
| InChIKey | HOXXXRNPBFBAIG-KBWKTKFASA-N |
| XLogP | 3.41 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|