C13H24N4O2 — CID 90429235
(2S,5S,8S)-2,5,8-trimethyl-9-methylidene-1,4,7,10-tetrazacyclotridecane-3,6-dione (PubChem CID 90429235) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (2S,5S,8S)-2,5,8-trimethyl-9-methylidene-1,4,7,10-tetrazacyclotridecane-3,6-dione.
| Compound Name | (2S,5S,8S)-2,5,8-trimethyl-9-methylidene-1,4,7,10-tetrazacyclotridecane-3,6-dione |
|---|---|
| PubChem CID | 90429235 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | (2S,5S,8S)-2,5,8-trimethyl-9-methylidene-1,4,7,10-tetrazacyclotridecane-3,6-dione |
| SMILES | C=C1NCCCN[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@H]1C |
| InChI | InChI=1S/C13H24N4O2/c1-8-9(2)16-13(19)11(4)17-12(18)10(3)15-7-5-6-14-8/h9-11,14-15H,1,5-7H2,2-4H3,(H,16,19)(H,17,18)/t9-,10-,11-/m0/s1 |
| InChIKey | HBJAFOAHGBYDMI-DCAQKATOSA-N |
| XLogP | -0.52 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |