C14H26N4O2 — CID 90429238
(2S,5S,8S)-1,2,5,8-tetramethyl-9-methylidene-1,4,7,10-tetrazacyclotridecane-3,6-dione (PubChem CID 90429238) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is (2S,5S,8S)-1,2,5,8-tetramethyl-9-methylidene-1,4,7,10-tetrazacyclotridecane-3,6-dione.
| Compound Name | (2S,5S,8S)-1,2,5,8-tetramethyl-9-methylidene-1,4,7,10-tetrazacyclotridecane-3,6-dione |
|---|---|
| PubChem CID | 90429238 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | (2S,5S,8S)-1,2,5,8-tetramethyl-9-methylidene-1,4,7,10-tetrazacyclotridecane-3,6-dione |
| SMILES | C=C1NCCCN(C)[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@H]1C |
| InChI | InChI=1S/C14H26N4O2/c1-9-10(2)16-13(19)11(3)17-14(20)12(4)18(5)8-6-7-15-9/h10-12,15H,1,6-8H2,2-5H3,(H,16,19)(H,17,20)/t10-,11-,12-/m0/s1 |
| InChIKey | IGDLNENKYSHRMW-SRVKXCTJSA-N |
| XLogP | -0.18 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |