C26H23ClFN3O5 — CID 90429647
prop-2-enyl 2-[6-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-7-fluoro-3-oxo-2-phenyl-1,4-benzoxazin-4-yl]acetate (PubChem CID 90429647) has the molecular formula C26H23ClFN3O5 and a molecular weight of 511.94 g/mol. Its IUPAC name is prop-2-enyl 2-[6-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-7-fluoro-3-oxo-2-phenyl-1,4-benzoxazin-4-yl]acetate.
| Compound Name | prop-2-enyl 2-[6-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-7-fluoro-3-oxo-2-phenyl-1,4-benzoxazin-4-yl]acetate |
|---|---|
| PubChem CID | 90429647 |
| Molecular Formula | C26H23ClFN3O5 |
| Molecular Weight | 511.94 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | prop-2-enyl 2-[6-(1-chloro-3-oxo-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-2-yl)-7-fluoro-3-oxo-2-phenyl-1,4-benzoxazin-4-yl]acetate |
| SMILES | C=CCOC(=O)CN1C(=O)C(c2ccccc2)Oc2cc(F)c(-c3c(Cl)n4n(c3=O)CCCC4)cc21 |
| InChI | InChI=1S/C26H23ClFN3O5/c1-2-12-35-21(32)15-29-19-13-17(22-24(27)30-10-6-7-11-31(30)25(22)33)18(28)14-20(19)36-23(26(29)34)16-8-4-3-5-9-16/h2-5,8-9,13-14,23H,1,6-7,10-12,15H2 |
| InChIKey | LSGBYMJXGNJYCT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 82.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.94 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|