C12H12N4O6S2 — CID 90429812
2-[(7-amino-5-methylidene-1,3-diazepin-4-yl)amino]benzene-1,4-disulfonic acid (PubChem CID 90429812) has the molecular formula C12H12N4O6S2 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-[(7-amino-5-methylidene-1,3-diazepin-4-yl)amino]benzene-1,4-disulfonic acid.
| Compound Name | 2-[(7-amino-5-methylidene-1,3-diazepin-4-yl)amino]benzene-1,4-disulfonic acid |
|---|---|
| PubChem CID | 90429812 |
| Molecular Formula | C12H12N4O6S2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 2-[(7-amino-5-methylidene-1,3-diazepin-4-yl)amino]benzene-1,4-disulfonic acid |
| SMILES | C=C1C=C(N)N=CN=C1Nc1cc(S(=O)(=O)O)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C12H12N4O6S2/c1-7-4-11(13)14-6-15-12(7)16-9-5-8(23(17,18)19)2-3-10(9)24(20,21)22/h2-6H,1,13H2,(H,14,15,16)(H,17,18,19)(H,20,21,22) |
| InChIKey | NGLMRAASZYCRAY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 171.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|