C22H20ClFN4O — CID 90430628
(1R,2R,4S,5S,7S)-N-[(1S)-2-[4-(6-chloro-3-pyridinyl)-2-fluorophenyl]-1-cyanoethyl]-6-azatricyclo[3.2.1.02,4]octane-7-carboxamide (PubChem CID 90430628) has the molecular formula C22H20ClFN4O and a molecular weight of 410.88 g/mol. Its IUPAC name is (1R,2R,4S,5S,7S)-N-[(1S)-2-[4-(6-chloro-3-pyridinyl)-2-fluorophenyl]-1-cyanoethyl]-6-azatricyclo[3.2.1.02,4]octane-7-carboxamide.
| Compound Name | (1R,2R,4S,5S,7S)-N-[(1S)-2-[4-(6-chloro-3-pyridinyl)-2-fluorophenyl]-1-cyanoethyl]-6-azatricyclo[3.2.1.02,4]octane-7-carboxamide |
|---|---|
| PubChem CID | 90430628 |
| Molecular Formula | C22H20ClFN4O |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (1R,2R,4S,5S,7S)-N-[(1S)-2-[4-(6-chloro-3-pyridinyl)-2-fluorophenyl]-1-cyanoethyl]-6-azatricyclo[3.2.1.02,4]octane-7-carboxamide |
| SMILES | N#C[C@H](Cc1ccc(-c2ccc(Cl)nc2)cc1F)NC(=O)[C@H]1N[C@H]2C[C@@H]1[C@@H]1C[C@@H]12 |
| InChI | InChI=1S/C22H20ClFN4O/c23-20-4-3-13(10-26-20)11-1-2-12(18(24)6-11)5-14(9-25)27-22(29)21-17-8-19(28-21)16-7-15(16)17/h1-4,6,10,14-17,19,21,28H,5,7-8H2,(H,27,29)/t14-,15+,16-,17+,19-,21-/m0/s1 |
| InChIKey | ZGRYOFAIQXJOSA-TXQSJXHQSA-N |
| XLogP | 3.09 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|