C26H30N8O5S — CID 90431127
3-[10-(oxan-4-yl)-6,13,16-trioxo-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-15-yl]propanamide (PubChem CID 90431127) has the molecular formula C26H30N8O5S and a molecular weight of 566.64 g/mol. Its IUPAC name is 3-[10-(oxan-4-yl)-6,13,16-trioxo-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-15-yl]propanamide.
| Compound Name | 3-[10-(oxan-4-yl)-6,13,16-trioxo-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-15-yl]propanamide |
|---|---|
| PubChem CID | 90431127 |
| Molecular Formula | C26H30N8O5S |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 3-[10-(oxan-4-yl)-6,13,16-trioxo-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaen-15-yl]propanamide |
| SMILES | NC(=O)CCC1NC(=O)c2nn(C3CCOCC3)cc2NC(=O)c2csc(n2)-c2ccnc(c2)CCCNC1=O |
| InChI | InChI=1S/C26H30N8O5S/c27-21(35)4-3-18-23(36)29-8-1-2-16-12-15(5-9-28-16)26-32-20(14-40-26)24(37)31-19-13-34(17-6-10-39-11-7-17)33-22(19)25(38)30-18/h5,9,12-14,17-18H,1-4,6-8,10-11H2,(H2,27,35)(H,29,36)(H,30,38)(H,31,37) |
| InChIKey | TVZZGRCIXMNSPG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 183.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |