C23H27N7O3S — CID 90431135
10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione (PubChem CID 90431135) has the molecular formula C23H27N7O3S and a molecular weight of 481.58 g/mol. Its IUPAC name is 10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione.
| Compound Name | 10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 90431135 |
| Molecular Formula | C23H27N7O3S |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | 10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NCCNCCCc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C23H27N7O3S/c31-21-19-14-34-23(28-19)15-3-7-25-16(12-15)2-1-6-24-8-9-26-22(32)20-18(27-21)13-30(29-20)17-4-10-33-11-5-17/h3,7,12-14,17,24H,1-2,4-6,8-11H2,(H,26,32)(H,27,31) |
| InChIKey | IZWGIJDOSIGHDL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |