C24H28N6O4S — CID 90431143
10-(oxan-4-yl)-18-oxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione (PubChem CID 90431143) has the molecular formula C24H28N6O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is 10-(oxan-4-yl)-18-oxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione.
| Compound Name | 10-(oxan-4-yl)-18-oxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
|---|---|
| PubChem CID | 90431143 |
| Molecular Formula | C24H28N6O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 10-(oxan-4-yl)-18-oxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
| SMILES | O=C1Nc2cn(C3CCOCC3)nc2C(=O)NCCCOCCCc2cc(ccn2)-c2nc1cs2 |
| InChI | InChI=1S/C24H28N6O4S/c31-22-20-15-35-24(28-20)16-4-8-25-17(13-16)3-1-9-33-10-2-7-26-23(32)21-19(27-22)14-30(29-21)18-5-11-34-12-6-18/h4,8,13-15,18H,1-3,5-7,9-12H2,(H,26,32)(H,27,31) |
| InChIKey | KYYXQHWBXBIHPH-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |