C20H22N6O3S — CID 90431264
10-methyl-17-oxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione (PubChem CID 90431264) has the molecular formula C20H22N6O3S and a molecular weight of 426.50 g/mol. Its IUPAC name is 10-methyl-17-oxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione.
| Compound Name | 10-methyl-17-oxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
|---|---|
| PubChem CID | 90431264 |
| Molecular Formula | C20H22N6O3S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 10-methyl-17-oxa-3-thia-7,10,11,14,23,27-hexazatetracyclo[20.3.1.12,5.08,12]heptacosa-1(26),2(27),4,8,11,22,24-heptaene-6,13-dione |
| SMILES | Cn1cc2c(n1)C(=O)NCCOCCCCc1cc(ccn1)-c1nc(cs1)C(=O)N2 |
| InChI | InChI=1S/C20H22N6O3S/c1-26-11-15-17(25-26)19(28)22-7-9-29-8-3-2-4-14-10-13(5-6-21-14)20-24-16(12-30-20)18(27)23-15/h5-6,10-12H,2-4,7-9H2,1H3,(H,22,28)(H,23,27) |
| InChIKey | SVLPGPNBZCHENB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |