C25H29N7O4S — CID 90431290
17-acetyl-10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione (PubChem CID 90431290) has the molecular formula C25H29N7O4S and a molecular weight of 523.62 g/mol. Its IUPAC name is 17-acetyl-10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione.
| Compound Name | 17-acetyl-10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 90431290 |
| Molecular Formula | C25H29N7O4S |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | 17-acetyl-10-(oxan-4-yl)-3-thia-7,10,11,14,17,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
| SMILES | CC(=O)N1CCCc2cc(ccn2)-c2nc(cs2)C(=O)Nc2cn(C3CCOCC3)nc2C(=O)NCC1 |
| InChI | InChI=1S/C25H29N7O4S/c1-16(33)31-9-2-3-18-13-17(4-7-26-18)25-29-21(15-37-25)23(34)28-20-14-32(19-5-11-36-12-6-19)30-22(20)24(35)27-8-10-31/h4,7,13-15,19H,2-3,5-6,8-12H2,1H3,(H,27,35)(H,28,34) |
| InChIKey | XMOHVGDTQSYSSY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 131.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |