C19H21N7O2S — CID 90431295
10,19-dimethyl-3-thia-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione (PubChem CID 90431295) has the molecular formula C19H21N7O2S and a molecular weight of 411.49 g/mol. Its IUPAC name is 10,19-dimethyl-3-thia-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione.
| Compound Name | 10,19-dimethyl-3-thia-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
|---|---|
| PubChem CID | 90431295 |
| Molecular Formula | C19H21N7O2S |
| Molecular Weight | 411.49 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 10,19-dimethyl-3-thia-7,10,11,14,19,21,25-heptazatetracyclo[18.3.1.12,5.08,12]pentacosa-1(24),2(25),4,8,11,20,22-heptaene-6,13-dione |
| SMILES | CN1CCCCNC(=O)c2nn(C)cc2NC(=O)c2csc(n2)-c2ccnc1c2 |
| InChI | InChI=1S/C19H21N7O2S/c1-25-8-4-3-6-21-18(28)16-13(10-26(2)24-16)22-17(27)14-11-29-19(23-14)12-5-7-20-15(25)9-12/h5,7,9-11H,3-4,6,8H2,1-2H3,(H,21,28)(H,22,27) |
| InChIKey | CKVLVDQSWXJUPF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 105.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |