C12H12F4O5S — CID 90431306
1,1,2,2-tetrafluoro-2-(tricyclo[3.3.1.02,7]non-2-ene-1-carbonyloxy)ethanesulfonic acid (PubChem CID 90431306) has the molecular formula C12H12F4O5S and a molecular weight of 344.28 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(tricyclo[3.3.1.02,7]non-2-ene-1-carbonyloxy)ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-(tricyclo[3.3.1.02,7]non-2-ene-1-carbonyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 90431306 |
| Molecular Formula | C12H12F4O5S |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(tricyclo[3.3.1.02,7]non-2-ene-1-carbonyloxy)ethanesulfonic acid |
| SMILES | O=C(OC(F)(F)C(F)(F)S(=O)(=O)O)C12CC3CC=C1C(C3)C2 |
| InChI | InChI=1S/C12H12F4O5S/c13-11(14,12(15,16)22(18,19)20)21-9(17)10-4-6-1-2-8(10)7(3-6)5-10/h2,6-7H,1,3-5H2,(H,18,19,20) |
| InChIKey | UPQKRGYVRMISNP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|