C12H14F2O5S — CID 90431334
1,1-difluoro-2-(tricyclo[3.3.1.02,7]non-2-ene-1-carbonyloxy)ethanesulfonic acid (PubChem CID 90431334) has the molecular formula C12H14F2O5S and a molecular weight of 308.30 g/mol. Its IUPAC name is 1,1-difluoro-2-(tricyclo[3.3.1.02,7]non-2-ene-1-carbonyloxy)ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-(tricyclo[3.3.1.02,7]non-2-ene-1-carbonyloxy)ethanesulfonic acid |
|---|---|
| PubChem CID | 90431334 |
| Molecular Formula | C12H14F2O5S |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1,1-difluoro-2-(tricyclo[3.3.1.02,7]non-2-ene-1-carbonyloxy)ethanesulfonic acid |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)O)C12CC3CC=C1C(C3)C2 |
| InChI | InChI=1S/C12H14F2O5S/c13-12(14,20(16,17)18)6-19-10(15)11-4-7-1-2-9(11)8(3-7)5-11/h2,7-8H,1,3-6H2,(H,16,17,18) |
| InChIKey | GQWABAZHCDVZER-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|