C23H27N7O4S — CID 90431412
20-methyl-10-(oxan-4-yl)-17-oxa-3-thia-7,10,11,14,20,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione (PubChem CID 90431412) has the molecular formula C23H27N7O4S and a molecular weight of 497.58 g/mol. Its IUPAC name is 20-methyl-10-(oxan-4-yl)-17-oxa-3-thia-7,10,11,14,20,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione.
| Compound Name | 20-methyl-10-(oxan-4-yl)-17-oxa-3-thia-7,10,11,14,20,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
|---|---|
| PubChem CID | 90431412 |
| Molecular Formula | C23H27N7O4S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 20-methyl-10-(oxan-4-yl)-17-oxa-3-thia-7,10,11,14,20,22,26-heptazatetracyclo[19.3.1.12,5.08,12]hexacosa-1(25),2(26),4,8,11,21,23-heptaene-6,13-dione |
| SMILES | CN1CCOCCNC(=O)c2nn(C3CCOCC3)cc2NC(=O)c2csc(n2)-c2ccnc1c2 |
| InChI | InChI=1S/C23H27N7O4S/c1-29-7-11-34-10-6-25-22(32)20-17(13-30(28-20)16-3-8-33-9-4-16)26-21(31)18-14-35-23(27-18)15-2-5-24-19(29)12-15/h2,5,12-14,16H,3-4,6-11H2,1H3,(H,25,32)(H,26,31) |
| InChIKey | DNLRMYFANCWAHU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 123.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |