C14H19F6NO5S2 — CID 90431507
3-(1-adamantylmethylsulfamoyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 90431507) has the molecular formula C14H19F6NO5S2 and a molecular weight of 459.43 g/mol. Its IUPAC name is 3-(1-adamantylmethylsulfamoyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-(1-adamantylmethylsulfamoyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 90431507 |
| Molecular Formula | C14H19F6NO5S2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 3-(1-adamantylmethylsulfamoyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H19F6NO5S2/c15-12(16,14(19,20)28(24,25)26)13(17,18)27(22,23)21-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10,21H,1-7H2,(H,24,25,26) |
| InChIKey | QJNCGDPEKQJBSK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|