C25H25N7O2 — CID 90431810
15-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2,10,14,16-tetrazatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3,5,7,11,13(17),14-heptaen-9-one (PubChem CID 90431810) has the molecular formula C25H25N7O2 and a molecular weight of 455.52 g/mol. Its IUPAC name is 15-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2,10,14,16-tetrazatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3,5,7,11,13(17),14-heptaen-9-one.
| Compound Name | 15-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2,10,14,16-tetrazatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3,5,7,11,13(17),14-heptaen-9-one |
|---|---|
| PubChem CID | 90431810 |
| Molecular Formula | C25H25N7O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 15-[2-methoxy-4-(4-methylpiperazin-1-yl)anilino]-2,10,14,16-tetrazatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3,5,7,11,13(17),14-heptaen-9-one |
| SMILES | COc1cc(N2CCN(C)CC2)ccc1Nc1nc2c3c(ccn3C(=O)c3ccccc3N2)n1 |
| InChI | InChI=1S/C25H25N7O2/c1-30-11-13-31(14-12-30)16-7-8-19(21(15-16)34-2)27-25-28-20-9-10-32-22(20)23(29-25)26-18-6-4-3-5-17(18)24(32)33/h3-10,15H,11-14H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | AEPYDBQIXWKGOV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |