C50H30N8 — CID 90432001
20-[4,6-bis(3-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]-3,10,20-triazaheptacyclo[15.11.0.02,10.04,9.011,16.019,27.021,26]octacosa-1(17),2,4,6,8,11,13,15,18,21,23,25,27-tridecaene (PubChem CID 90432001) has the molecular formula C50H30N8 and a molecular weight of 742.85 g/mol. Its IUPAC name is 20-[4,6-bis(3-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]-3,10,20-triazaheptacyclo[15.11.0.02,10.04,9.011,16.019,27.021,26]octacosa-1(17),2,4,6,8,11,13,15,18,21,23,25,27-tridecaene.
| Compound Name | 20-[4,6-bis(3-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]-3,10,20-triazaheptacyclo[15.11.0.02,10.04,9.011,16.019,27.021,26]octacosa-1(17),2,4,6,8,11,13,15,18,21,23,25,27-tridecaene |
|---|---|
| PubChem CID | 90432001 |
| Molecular Formula | C50H30N8 |
| Molecular Weight | 742.85 g/mol |
| Exact Mass | 742.26 |
| IUPAC Name | 20-[4,6-bis(3-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]-3,10,20-triazaheptacyclo[15.11.0.02,10.04,9.011,16.019,27.021,26]octacosa-1(17),2,4,6,8,11,13,15,18,21,23,25,27-tridecaene |
| SMILES | c1ccc(-c2cccc(-c3nc(-c4cccc(-c5ccccn5)c4)nc(-n4c5ccccc5c5cc6c(cc54)c4ccccc4n4c5ccccc5nc64)n3)c2)nc1 |
| InChI | InChI=1S/C50H30N8/c1-4-22-43-35(17-1)37-30-46-38(29-39(37)49-53-42-21-3-6-24-45(42)57(43)49)36-18-2-5-23-44(36)58(46)50-55-47(33-15-11-13-31(27-33)40-19-7-9-25-51-40)54-48(56-50)34-16-12-14-32(28-34)41-20-8-10-26-52-41/h1-30H |
| InChIKey | AGTKRDFRZMEUHZ-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 86.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.85 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|