C31H28N4O7S — CID 90432244
5-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 90432244) has the molecular formula C31H28N4O7S and a molecular weight of 600.65 g/mol. Its IUPAC name is 5-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 90432244 |
| Molecular Formula | C31H28N4O7S |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | 5-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3c(c2)CCC(C(=O)N(CC(=O)O)Cc2ccc4sc(C(=O)O)cc4c2)C3)cc1 |
| InChI | InChI=1S/C31H28N4O7S/c32-31(33)34-23-7-4-18(5-8-23)30(41)42-24-9-6-19-12-21(3-2-20(19)13-24)28(38)35(16-27(36)37)15-17-1-10-25-22(11-17)14-26(43-25)29(39)40/h1,4-11,13-14,21H,2-3,12,15-16H2,(H,36,37)(H,39,40)(H4,32,33,34) |
| InChIKey | YTZQXQLEPNMCJL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|