C33H36N4O7 — CID 90432341
3-[[benzyl-[2-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]amino]methyl]pentanedioic acid (PubChem CID 90432341) has the molecular formula C33H36N4O7 and a molecular weight of 600.67 g/mol. Its IUPAC name is 3-[[benzyl-[2-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]amino]methyl]pentanedioic acid.
| Compound Name | 3-[[benzyl-[2-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]amino]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 90432341 |
| Molecular Formula | C33H36N4O7 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | 3-[[benzyl-[2-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1,2,3,4-tetrahydronaphthalen-1-yl]acetyl]amino]methyl]pentanedioic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3c(c2)CCCC3CC(=O)N(Cc2ccccc2)CC(CC(=O)O)CC(=O)O)cc1 |
| InChI | InChI=1S/C33H36N4O7/c34-33(35)36-26-11-9-23(10-12-26)32(43)44-27-13-14-28-24(17-27)7-4-8-25(28)18-29(38)37(19-21-5-2-1-3-6-21)20-22(15-30(39)40)16-31(41)42/h1-3,5-6,9-14,17,22,25H,4,7-8,15-16,18-20H2,(H,39,40)(H,41,42)(H4,34,35,36) |
| InChIKey | TZQOQBBUWPPYRK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|