C28H37N5O4 — CID 90433135
2-[4-[5-[5-(6-methylheptoxy)-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraen-11-yl]-2-pyridinyl]cyclohexyl]acetic acid (PubChem CID 90433135) has the molecular formula C28H37N5O4 and a molecular weight of 507.64 g/mol. Its IUPAC name is 2-[4-[5-[5-(6-methylheptoxy)-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraen-11-yl]-2-pyridinyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[5-[5-(6-methylheptoxy)-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraen-11-yl]-2-pyridinyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 90433135 |
| Molecular Formula | C28H37N5O4 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 2-[4-[5-[5-(6-methylheptoxy)-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraen-11-yl]-2-pyridinyl]cyclohexyl]acetic acid |
| SMILES | CC(C)CCCCCOc1nc2c3c(n1)OCCN(c1ccc(C4CCC(CC(=O)O)CC4)nc1)C3=N2 |
| InChI | InChI=1S/C28H37N5O4/c1-18(2)6-4-3-5-14-37-28-31-25-24-26(30-25)33(13-15-36-27(24)32-28)21-11-12-22(29-17-21)20-9-7-19(8-10-20)16-23(34)35/h11-12,17-20H,3-10,13-16H2,1-2H3,(H,34,35) |
| InChIKey | KNRKHKQSUDZJDO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 110.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|