C19H23F2IN2O4 — CID 90433580
2-methylpropyl 2-[(2,3-difluoro-4-iodophenyl)methyl]-5-hydroxy-1,6,6-trimethyl-3-oxopyridazine-4-carboxylate (PubChem CID 90433580) has the molecular formula C19H23F2IN2O4 and a molecular weight of 508.30 g/mol. Its IUPAC name is 2-methylpropyl 2-[(2,3-difluoro-4-iodophenyl)methyl]-5-hydroxy-1,6,6-trimethyl-3-oxopyridazine-4-carboxylate.
| Compound Name | 2-methylpropyl 2-[(2,3-difluoro-4-iodophenyl)methyl]-5-hydroxy-1,6,6-trimethyl-3-oxopyridazine-4-carboxylate |
|---|---|
| PubChem CID | 90433580 |
| Molecular Formula | C19H23F2IN2O4 |
| Molecular Weight | 508.30 g/mol |
| Exact Mass | 508.07 |
| IUPAC Name | 2-methylpropyl 2-[(2,3-difluoro-4-iodophenyl)methyl]-5-hydroxy-1,6,6-trimethyl-3-oxopyridazine-4-carboxylate |
| SMILES | CC(C)COC(=O)C1=C(O)C(C)(C)N(C)N(Cc2ccc(I)c(F)c2F)C1=O |
| InChI | InChI=1S/C19H23F2IN2O4/c1-10(2)9-28-18(27)13-16(25)19(3,4)23(5)24(17(13)26)8-11-6-7-12(22)15(21)14(11)20/h6-7,10,25H,8-9H2,1-5H3 |
| InChIKey | ZCEHKZBVAMINQC-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.30 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|