C19H25F2N — CID 90433653
(E)-1-[5-(1,1-difluoroethyl)-2-methylphenyl]-N-ethenyl-3,4,4-trimethylpent-2-en-1-imine (PubChem CID 90433653) has the molecular formula C19H25F2N and a molecular weight of 305.41 g/mol. Its IUPAC name is (E)-1-[5-(1,1-difluoroethyl)-2-methylphenyl]-N-ethenyl-3,4,4-trimethylpent-2-en-1-imine.
| Compound Name | (E)-1-[5-(1,1-difluoroethyl)-2-methylphenyl]-N-ethenyl-3,4,4-trimethylpent-2-en-1-imine |
|---|---|
| PubChem CID | 90433653 |
| Molecular Formula | C19H25F2N |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | (E)-1-[5-(1,1-difluoroethyl)-2-methylphenyl]-N-ethenyl-3,4,4-trimethylpent-2-en-1-imine |
| SMILES | C=C/N=C(\C=C(/C)C(C)(C)C)c1cc(C(C)(F)F)ccc1C |
| InChI | InChI=1S/C19H25F2N/c1-8-22-17(11-14(3)18(4,5)6)16-12-15(19(7,20)21)10-9-13(16)2/h8-12H,1H2,2-7H3/b14-11+,22-17+ |
| InChIKey | KEAXBPWPOHRYLM-LOAFYOGGSA-N |
| XLogP | 6.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|