C21H32FN — CID 90434014
(E)-1-[5-(2-fluoropropan-2-yl)-2-methylphenyl]-3,4,4-trimethyl-N-propylpent-2-en-1-imine (PubChem CID 90434014) has the molecular formula C21H32FN and a molecular weight of 317.49 g/mol. Its IUPAC name is (E)-1-[5-(2-fluoropropan-2-yl)-2-methylphenyl]-3,4,4-trimethyl-N-propylpent-2-en-1-imine.
| Compound Name | (E)-1-[5-(2-fluoropropan-2-yl)-2-methylphenyl]-3,4,4-trimethyl-N-propylpent-2-en-1-imine |
|---|---|
| PubChem CID | 90434014 |
| Molecular Formula | C21H32FN |
| Molecular Weight | 317.49 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | (E)-1-[5-(2-fluoropropan-2-yl)-2-methylphenyl]-3,4,4-trimethyl-N-propylpent-2-en-1-imine |
| SMILES | CCC/N=C(\C=C(/C)C(C)(C)C)c1cc(C(C)(C)F)ccc1C |
| InChI | InChI=1S/C21H32FN/c1-9-12-23-19(13-16(3)20(4,5)6)18-14-17(21(7,8)22)11-10-15(18)2/h10-11,13-14H,9,12H2,1-8H3/b16-13+,23-19+ |
| InChIKey | NEGTXMTUDJFCBO-RCDKTZPXSA-N |
| XLogP | 6.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.49 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|