C24H30ClN3O4 — CID 90434135
5-[[2-(2-chloro-3-pyridinyl)cyclohexyl]methoxy]-2-(2-morpholin-4-ylethoxy)pyridine-4-carbaldehyde (PubChem CID 90434135) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is 5-[[2-(2-chloro-3-pyridinyl)cyclohexyl]methoxy]-2-(2-morpholin-4-ylethoxy)pyridine-4-carbaldehyde.
| Compound Name | 5-[[2-(2-chloro-3-pyridinyl)cyclohexyl]methoxy]-2-(2-morpholin-4-ylethoxy)pyridine-4-carbaldehyde |
|---|---|
| PubChem CID | 90434135 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 5-[[2-(2-chloro-3-pyridinyl)cyclohexyl]methoxy]-2-(2-morpholin-4-ylethoxy)pyridine-4-carbaldehyde |
| SMILES | O=Cc1cc(OCCN2CCOCC2)ncc1OCC1CCCCC1c1cccnc1Cl |
| InChI | InChI=1S/C24H30ClN3O4/c25-24-21(6-3-7-26-24)20-5-2-1-4-18(20)17-32-22-15-27-23(14-19(22)16-29)31-13-10-28-8-11-30-12-9-28/h3,6-7,14-16,18,20H,1-2,4-5,8-13,17H2 |
| InChIKey | LGQUYMGFFCJTQE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|