C13H15N — CID 90434181
N-[(1Z,3E)-3-(4-methylphenyl)penta-1,3-dienyl]methanimine (PubChem CID 90434181) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is N-[(1Z,3E)-3-(4-methylphenyl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-3-(4-methylphenyl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 90434181 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-[(1Z,3E)-3-(4-methylphenyl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C\C(=C/C)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15N/c1-4-12(9-10-14-3)13-7-5-11(2)6-8-13/h4-10H,3H2,1-2H3/b10-9-,12-4+ |
| InChIKey | NAOJXGWDTDNHNY-MMQHMWHNSA-N |
| XLogP | 3.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|