C13H10Cl2FN3O4 — CID 90434548
8-(2,4-dichloro-5-nitrophenyl)-9-fluoro-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepin-7-one (PubChem CID 90434548) has the molecular formula C13H10Cl2FN3O4 and a molecular weight of 362.14 g/mol. Its IUPAC name is 8-(2,4-dichloro-5-nitrophenyl)-9-fluoro-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepin-7-one.
| Compound Name | 8-(2,4-dichloro-5-nitrophenyl)-9-fluoro-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepin-7-one |
|---|---|
| PubChem CID | 90434548 |
| Molecular Formula | C13H10Cl2FN3O4 |
| Molecular Weight | 362.14 g/mol |
| Exact Mass | 361.00 |
| IUPAC Name | 8-(2,4-dichloro-5-nitrophenyl)-9-fluoro-1,2,4,5-tetrahydropyrazolo[1,2-d][1,4,5]oxadiazepin-7-one |
| SMILES | O=c1c(-c2cc([N+](=O)[O-])c(Cl)cc2Cl)c(F)n2n1CCOCC2 |
| InChI | InChI=1S/C13H10Cl2FN3O4/c14-8-6-9(15)10(19(21)22)5-7(8)11-12(16)17-1-3-23-4-2-18(17)13(11)20/h5-6H,1-4H2 |
| InChIKey | LYWSALYYLFVYTL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 79.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.14 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|