C13H12Cl2FN3O3 — CID 90434608
1-chloro-2-[4-chloro-2-fluoro-5-(hydroperoxyamino)phenyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-3-one (PubChem CID 90434608) has the molecular formula C13H12Cl2FN3O3 and a molecular weight of 348.16 g/mol. Its IUPAC name is 1-chloro-2-[4-chloro-2-fluoro-5-(hydroperoxyamino)phenyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-3-one.
| Compound Name | 1-chloro-2-[4-chloro-2-fluoro-5-(hydroperoxyamino)phenyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-3-one |
|---|---|
| PubChem CID | 90434608 |
| Molecular Formula | C13H12Cl2FN3O3 |
| Molecular Weight | 348.16 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 1-chloro-2-[4-chloro-2-fluoro-5-(hydroperoxyamino)phenyl]-5,6,7,8-tetrahydropyrazolo[1,2-a]pyridazin-3-one |
| SMILES | O=c1c(-c2cc(NOO)c(Cl)cc2F)c(Cl)n2n1CCCC2 |
| InChI | InChI=1S/C13H12Cl2FN3O3/c14-8-6-9(16)7(5-10(8)17-22-21)11-12(15)18-3-1-2-4-19(18)13(11)20/h5-6,17,21H,1-4H2 |
| InChIKey | QEGQRCBXUWYKKB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|