C31H35ClN2O5Si — CID 90435114
(3R,3aR,6R)-6-[6-chloro-5-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 90435114) has the molecular formula C31H35ClN2O5Si and a molecular weight of 579.17 g/mol. Its IUPAC name is (3R,3aR,6R)-6-[6-chloro-5-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R)-6-[6-chloro-5-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 90435114 |
| Molecular Formula | C31H35ClN2O5Si |
| Molecular Weight | 579.17 g/mol |
| Exact Mass | 578.20 |
| IUPAC Name | (3R,3aR,6R)-6-[6-chloro-5-(4-phenylphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | C[Si](C)(C)CCOCn1c(O[C@@H]2CO[C@H]3C2OC[C@H]3O)cc2nc(-c3ccc(-c4ccccc4)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C31H35ClN2O5Si/c1-40(2,3)14-13-36-19-34-25-15-23(32)29(22-11-9-21(10-12-22)20-7-5-4-6-8-20)33-24(25)16-28(34)39-27-18-38-30-26(35)17-37-31(27)30/h4-12,15-16,26-27,30-31,35H,13-14,17-19H2,1-3H3/t26-,27-,30-,31?/m1/s1 |
| InChIKey | PVZUGISUAHHHCE-SIVHTROOSA-N |
| XLogP | 6.24 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.17 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|