About 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole
5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole (PubChem CID 90435647) has the molecular formula C11H16F2N2
and a molecular weight of 214.26 g/mol. Its IUPAC name is 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole.
Molecular Properties
| Compound Name | 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole |
| PubChem CID | 90435647 |
| Molecular Formula | C11H16F2N2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole |
| SMILES | C[C@H]1CC(F)(F)CC[C@@H]1c1ccnn1C |
| InChI | InChI=1S/C11H16F2N2/c1-8-7-11(12,13)5-3-9(8)10-4-6-14-15(10)2/h4,6,8-9H,3,5,7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | WUPYOLXMZTZBHV-IUCAKERBSA-N |
| XLogP | 2.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole?
The IUPAC name of 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole (CID 90435647) is 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole.
What is the SMILES notation for 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole?
The canonical SMILES for 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole is C[C@H]1CC(F)(F)CC[C@@H]1c1ccnn1C.
What is the InChIKey of 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole?
The InChIKey is WUPYOLXMZTZBHV-IUCAKERBSA-N. The full InChI is InChI=1S/C11H16F2N2/c1-8-7-11(12,13)5-3-9(8)10-4-6-14-15(10)2/h4,6,8-9H,3,5,7H2,1-2H3/t8-,9-/m0/s1.
What are the key properties of 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole?
5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole has a molecular weight of 214.26 g/mol, XLogP of 2.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1S,2S)-4,4-difluoro-2-methylcyclohexyl]-1-methylpyrazole is sourced from PubChem (CID 90435647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).