About 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine
1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine (PubChem CID 90435666) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine.
Molecular Properties
| Compound Name | 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine |
| PubChem CID | 90435666 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine |
| SMILES | C=C/C=C(\C)N1CCN(CC)CC1 |
| InChI | InChI=1S/C11H20N2/c1-4-6-11(3)13-9-7-12(5-2)8-10-13/h4,6H,1,5,7-10H2,2-3H3/b11-6+ |
| InChIKey | RDGJRIQBSKAUEB-IZZDOVSWSA-N |
| XLogP | 1.71 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine?
The IUPAC name of 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine (CID 90435666) is 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine.
What is the SMILES notation for 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine?
The canonical SMILES for 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine is C=C/C=C(\C)N1CCN(CC)CC1.
What is the InChIKey of 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine?
The InChIKey is RDGJRIQBSKAUEB-IZZDOVSWSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-6-11(3)13-9-7-12(5-2)8-10-13/h4,6H,1,5,7-10H2,2-3H3/b11-6+.
What are the key properties of 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine?
1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine has a molecular weight of 180.29 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-[(2E)-penta-2,4-dien-2-yl]piperazine is sourced from PubChem (CID 90435666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).