C15H29ClO2Si2 — CID 90435946
[(1R,2R)-1-(2-chlorocyclohexa-1,5-dien-1-yl)-1-trimethylsilyloxypropan-2-yl]oxy-trimethylsilane (PubChem CID 90435946) has the molecular formula C15H29ClO2Si2 and a molecular weight of 333.02 g/mol. Its IUPAC name is [(1R,2R)-1-(2-chlorocyclohexa-1,5-dien-1-yl)-1-trimethylsilyloxypropan-2-yl]oxy-trimethylsilane.
| Compound Name | [(1R,2R)-1-(2-chlorocyclohexa-1,5-dien-1-yl)-1-trimethylsilyloxypropan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 90435946 |
| Molecular Formula | C15H29ClO2Si2 |
| Molecular Weight | 333.02 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [(1R,2R)-1-(2-chlorocyclohexa-1,5-dien-1-yl)-1-trimethylsilyloxypropan-2-yl]oxy-trimethylsilane |
| SMILES | C[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C1=C(Cl)CCC=C1 |
| InChI | InChI=1S/C15H29ClO2Si2/c1-12(17-19(2,3)4)15(18-20(5,6)7)13-10-8-9-11-14(13)16/h8,10,12,15H,9,11H2,1-7H3/t12-,15+/m1/s1 |
| InChIKey | HSZXSHGQSOCJMG-DOMZBBRYSA-N |
| XLogP | 5.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.02 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|