C38H25BrN4 — CID 90436006
2-[3-bromo-5-[3-(4-pyridin-2-ylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 90436006) has the molecular formula C38H25BrN4 and a molecular weight of 617.55 g/mol. Its IUPAC name is 2-[3-bromo-5-[3-(4-pyridin-2-ylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-bromo-5-[3-(4-pyridin-2-ylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 90436006 |
| Molecular Formula | C38H25BrN4 |
| Molecular Weight | 617.55 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | 2-[3-bromo-5-[3-(4-pyridin-2-ylphenyl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Brc1cc(-c2cccc(-c3ccc(-c4ccccn4)cc3)c2)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C38H25BrN4/c39-34-24-32(31-15-9-14-30(22-31)26-17-19-27(20-18-26)35-16-7-8-21-40-35)23-33(25-34)38-42-36(28-10-3-1-4-11-28)41-37(43-38)29-12-5-2-6-13-29/h1-25H |
| InChIKey | MXZMKBBBEZOKSZ-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.55 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |