About 1H-pyrano[2,3-b]pyrazine
1H-pyrano[2,3-b]pyrazine (PubChem CID 90436269) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1H-pyrano[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 1H-pyrano[2,3-b]pyrazine |
| PubChem CID | 90436269 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1H-pyrano[2,3-b]pyrazine |
| SMILES | C1=COC2=NC=CNC2=C1 |
| InChI | InChI=1S/C7H6N2O/c1-2-6-7(10-5-1)9-4-3-8-6/h1-5,8H |
| InChIKey | XDBYFGGRRFLIBY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrano[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrano[2,3-b]pyrazine?
The IUPAC name of 1H-pyrano[2,3-b]pyrazine (CID 90436269) is 1H-pyrano[2,3-b]pyrazine.
What is the SMILES notation for 1H-pyrano[2,3-b]pyrazine?
The canonical SMILES for 1H-pyrano[2,3-b]pyrazine is C1=COC2=NC=CNC2=C1.
What is the InChIKey of 1H-pyrano[2,3-b]pyrazine?
The InChIKey is XDBYFGGRRFLIBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c1-2-6-7(10-5-1)9-4-3-8-6/h1-5,8H.
What are the key properties of 1H-pyrano[2,3-b]pyrazine?
1H-pyrano[2,3-b]pyrazine has a molecular weight of 134.14 g/mol, XLogP of 0.89, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrano[2,3-b]pyrazine is sourced from PubChem (CID 90436269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).