C7H9F2N — CID 90436398
(1Z,3Z,5E)-2,6-difluoro-5-methylhexa-1,3,5-trien-1-amine (PubChem CID 90436398) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is (1Z,3Z,5E)-2,6-difluoro-5-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z,5E)-2,6-difluoro-5-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 90436398 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (1Z,3Z,5E)-2,6-difluoro-5-methylhexa-1,3,5-trien-1-amine |
| SMILES | CC(/C=C\C(F)=C\N)=C\F |
| InChI | InChI=1S/C7H9F2N/c1-6(4-8)2-3-7(9)5-10/h2-5H,10H2,1H3/b3-2-,6-4+,7-5- |
| InChIKey | AYAZJJWKWPUJIG-GDQASGNKSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|