About [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane
[(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane (PubChem CID 90436493) has the molecular formula C15H31ClO2Si2
and a molecular weight of 335.04 g/mol. Its IUPAC name is [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane |
| PubChem CID | 90436493 |
| Molecular Formula | C15H31ClO2Si2 |
| Molecular Weight | 335.04 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane |
| SMILES | C/C=C\C(=C(/C)Cl)C(O[Si](C)(C)C)C(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H31ClO2Si2/c1-10-11-14(12(2)16)15(18-20(7,8)9)13(3)17-19(4,5)6/h10-11,13,15H,1-9H3/b11-10-,14-12- |
| InChIKey | GQDNJEWQNDUVTB-QDUUWUCGSA-N |
| XLogP | 5.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.04 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane?
The IUPAC name of [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane (CID 90436493) is [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane.
What is the SMILES notation for [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane?
The canonical SMILES for [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane is C/C=C\C(=C(/C)Cl)C(O[Si](C)(C)C)C(C)O[Si](C)(C)C.
What is the InChIKey of [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane?
The InChIKey is GQDNJEWQNDUVTB-QDUUWUCGSA-N. The full InChI is InChI=1S/C15H31ClO2Si2/c1-10-11-14(12(2)16)15(18-20(7,8)9)13(3)17-19(4,5)6/h10-11,13,15H,1-9H3/b11-10-,14-12-.
What are the key properties of [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane?
[(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane has a molecular weight of 335.04 g/mol, XLogP of 5.54, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z,4Z)-4-(1-chloroethylidene)-2-trimethylsilyloxyhept-5-en-3-yl]oxy-trimethylsilane is sourced from PubChem (CID 90436493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).