C9H15FO2 — CID 90436494
(Z,2R,3R,4Z)-4-(1-fluoroethylidene)hept-5-ene-2,3-diol (PubChem CID 90436494) has the molecular formula C9H15FO2 and a molecular weight of 174.22 g/mol. Its IUPAC name is (Z,2R,3R,4Z)-4-(1-fluoroethylidene)hept-5-ene-2,3-diol.
| Compound Name | (Z,2R,3R,4Z)-4-(1-fluoroethylidene)hept-5-ene-2,3-diol |
|---|---|
| PubChem CID | 90436494 |
| Molecular Formula | C9H15FO2 |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.11 |
| IUPAC Name | (Z,2R,3R,4Z)-4-(1-fluoroethylidene)hept-5-ene-2,3-diol |
| SMILES | C/C=C\C(=C(/C)F)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C9H15FO2/c1-4-5-8(6(2)10)9(12)7(3)11/h4-5,7,9,11-12H,1-3H3/b5-4-,8-6-/t7-,9+/m1/s1 |
| InChIKey | TVXCHKUEYPHWHG-DXIXNZIUSA-N |
| XLogP | 1.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|