C14H23N2O8P — CID 90436524
[(2S,3R)-5-ethyl-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,4-dioxepan-2-yl]methyl methyl hydrogen phosphate (PubChem CID 90436524) has the molecular formula C14H23N2O8P and a molecular weight of 378.32 g/mol. Its IUPAC name is [(2S,3R)-5-ethyl-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,4-dioxepan-2-yl]methyl methyl hydrogen phosphate.
| Compound Name | [(2S,3R)-5-ethyl-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,4-dioxepan-2-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 90436524 |
| Molecular Formula | C14H23N2O8P |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [(2S,3R)-5-ethyl-3-(5-methyl-2,4-dioxopyrimidin-1-yl)-1,4-dioxepan-2-yl]methyl methyl hydrogen phosphate |
| SMILES | CCC1CCO[C@@H](COP(=O)(O)OC)[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C14H23N2O8P/c1-4-10-5-6-22-11(8-23-25(19,20)21-3)13(24-10)16-7-9(2)12(17)15-14(16)18/h7,10-11,13H,4-6,8H2,1-3H3,(H,19,20)(H,15,17,18)/t10?,11-,13+/m0/s1 |
| InChIKey | ZNLLROQVXQIWAJ-QMDRTORHSA-N |
| XLogP | 0.69 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|