C34H45NO2S — CID 90436531
4-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-1,2-dimethylphenothiazin-3-one (PubChem CID 90436531) has the molecular formula C34H45NO2S and a molecular weight of 531.81 g/mol. Its IUPAC name is 4-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-1,2-dimethylphenothiazin-3-one.
| Compound Name | 4-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-1,2-dimethylphenothiazin-3-one |
|---|---|
| PubChem CID | 90436531 |
| Molecular Formula | C34H45NO2S |
| Molecular Weight | 531.81 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | 4-[(3R,6E,10E)-3-hydroxy-3,7,11,15-tetramethylhexadeca-6,10,14-trienyl]-1,2-dimethylphenothiazin-3-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@@](C)(O)CCc1c2sc3ccccc3nc-2c(C)c(C)c1=O |
| InChI | InChI=1S/C34H45NO2S/c1-23(2)13-10-14-24(3)15-11-16-25(4)17-12-21-34(7,37)22-20-28-32(36)27(6)26(5)31-33(28)38-30-19-9-8-18-29(30)35-31/h8-9,13,15,17-19,37H,10-12,14,16,20-22H2,1-7H3/b24-15+,25-17+/t34-/m1/s1 |
| InChIKey | ZTBWHTYEUJMKBL-IDLWGITNSA-N |
| XLogP | 9.26 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.81 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|